Galanolakton
Galanolactone.svg
Galanolakton
IUPAC-név (3E)-3-[2-[(1R,2S)-5,5,8a-trimetilspiro[3,4,4a,6,7,8-hexahidro-1H-naftalin-2,2′-oxirán]-1-il]etilidén]oxolán-2-on
Kémiai azonosítók
CAS-szám 115753-79-2
PubChem 5317453
ChemSpider 9316811
MeSH galanolactone
SMILES
CC1(CCCC2(C1CCC3(C2CC=C4CCOC4=O)CO3)C)C
Kémiai és fizikai tulajdonságok
Kémiai képlet C20H30O3
Moláris tömeg 318,45 g/mol
Oldhatóság (aceton) oldható
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

A galanolakton egy diterpenoid lakton. Megtalálható a természetben a gyömbérben (eredetileg ebből állították elő) és a galangálban.[1] Acetonban oldódik, ezzel vonható ki a gyömbérből. Gátolja az 5-HT3 (szerotonin)receptort.[2]

ForrásokSzerkesztés

JegyzetekSzerkesztés

FordításSzerkesztés

Ez a szócikk részben vagy egészben a Galanolactone című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel.