Főmenü megnyitása

A nitrofurál (furacilin) halványsárga kristályos anyag. Antibiotikumként használják a bőr felületi sérüléseinek fertőtlenítésére (kenőcs formájában), valamint szájon át trypanosoma-fertőzés[1] ellen.

Nitrofurazone.png
Nitrofurál
IUPAC-név
5-nitro-2-furaldehid-szemikarbazid
Kémiai azonosítók
CAS-szám 59-87-0
PubChem 5447130
ChemSpider 4566720
DrugBank DB00336
KEGG C08042
ATC kód B05CA03, D08AF01 D09AA03 P01CC02 S01AX04 S02AA02 QG01AX90 QP51AC02
Gyógyszer szabadnév nitrofural
Gyógyszerkönyvi név Nitrofuralum
SMILES
O=[N+]([O-])c1oc(/C=N/NC(=O)N)cc1
InChI
1/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11)/b8-3+
StdInChIKey IAIWVQXQOWNYOU-FPYGCLRLSA-N
UNII X8XI70B5Z6
ChEMBL 869
Kémiai és fizikai tulajdonságok
Kémiai képlet C6H6N4O4
Moláris tömeg 198,14 g/mol
Nitrofurál 1:5000 hígítású vizes oldata

Mind Gram-pozitív, mind -negatív baktériumok ellen hatásos.

Mára új, hatékonyabb és biztonságosabb szerek jelentek meg, így használata háttérbe szorult.

ElőállításSzerkesztés

5-nitrofuraldehidből[2] és szemikarbazidból állítják elő.[3]

KészítményekSzerkesztés

Magyarországon nincs forgalomban nitrofurál-tartalmú készítmény, de a nemzetközi gyógyszerkereskedelem számos készítményt kínál.[4][5]

JegyzetekSzerkesztés

  1. Álomkór Archiválva 2010. május 30-i dátummal a Wayback Machine-ben (50plusz.hu)
  2. 5-nitro-2-furaldehyde[halott link] (WolframAlpha)
  3. Stillman, W. B.; Scott, A. B.; 1947, USA szabadalom(241664)
  4. Nitrofurazone (Drugs-About.com)
  5. Nitrofural (Drugs.com)

Kapcsolódó szócikkekSzerkesztés

Ez a szócikk részben vagy egészben a Nitrofurazone című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel.