„Biperidén” változatai közötti eltérés

a
Infobox keskenyítés
a (Bot: 12 interwiki link migrálva a Wikidata d:q414914 adatába)
a (Infobox keskenyítés)
{{gyógyszeresdoboz
| verifiedrevid = 321995216
| IUPACnév = (1''RS'',2''SR'',4''RS'')-1-(bicyclo[2.2.1]hept-5-en-2-yl)-1-phenyl-3-(piperidin- 1-yl)propan-1-ol
| Kép = Biperiden Stereoisomers.png
| Kép2 = Biperiden-3D-sticks.png
| Méret2 = 260px
| InChI = 1/C21H29NO/c23-21(19-7-3-1-4-8-19, 11-14-22-12-5-2-6-13-22) 20-16-17-9-10-18(20)15-17/ h1,3-4,7-10,17-18,20,23H,2,5-6,11-16H2
| InChIKey = YSXKPIUOCJLQIE-UHFFFAOYAP
| CASNo_Ref = {{cascite}}
| ATCelőtag = N04
| ATCutótag = AA02
| INN = biperiden
| PubChem = 2381
| DrugBank = APRD00725
| C = 21 | H = 29 | N = 1 | O = 1
| MolekulaTömeg = 311.461 g/mol
| smiles = OC(c1ccccc1)(CCN2CCCCC2)C4C3\C=C/C(C3)C4
| BioHaszn = 33 ± 5% (orális)
}}
 
A '''biperidén''' ([[INN]]: '''biperiden''') elsősorban egy antikolinerg gyógyszer, amely központi idegrendszeri hatást fejt ki. Rendelkezik perifériás hatással is, de ez minimális az [[atropin]]éval összehasonlítva. A biperidén kompetitíven kötődik a perifériás és központi muscarinreceptorokhoz (elsősorban M1-hez). Állatkísérletekben a biperidén kivédte a centrálisan-ható kolinerg szerek által kiváltott Parkinson-szerű hatásokat (tremor és rigiditás).
 
{{phhg8|Biperideni hydrochloridum}}
22 037

szerkesztés