„Afamelanotid” változatai közötti eltérés

2 976 bájt hozzáadva ,  3 évvel ezelőtt
nincs szerkesztési összefoglaló
[nem ellenőrzött változat][nem ellenőrzött változat]
Nincs szerkesztési összefoglaló
Nincs szerkesztési összefoglaló
{{UPE|date=July 2018}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477364562
| IUPAC_name = ''N''-acetil-<small>L</small>-szeril-<small>L</small>-tirozil-<small>L</small>-szeril-<small>L</small>-norleucil-<small>L</small>-α-glutamil-<small>L</small>-hisztidil-<small>D</small>-fenilalanil-<small>L</small>-arginil-<small>L</small>-triptopilglicil-<small>L</small>-lizil-<small>L</small>-prolil-<small>L</small>-valinamid
| image = Melanotan.png
| pronounce={{IPAc-en|audio=Afamelanotide-pronunciation.ogg|ˌ|æ|f|ə|m|ɛ|ˈ|l|æ|n|oʊ-|t|aɪ|d}}
| tradename = Scenesse
| Drugs.com = {{Drugs.com|UK|scenesse}}
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 75921-69-6
| ATC_prefix = D02
| ATC_suffix = BB02
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = QW68W3J66U
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 441738
| PubChem = 16154396
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D10511
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 17310725
| C = 78 | H = 111 | N = 21 | O = 19
| molecular_weight = 1646,845 g/mol
| smiles = O=C(N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)N)C(C)C)CCC1)CCCCN)Cc3c2ccccc2[nH]c3)CCCNC(=[N@H])N)Cc4ccccc4)Cc5[nH]cnc5)CCC(=O)O)CCCC)CO)Cc6ccc(O)cc6)[C@@H](NC(=O)C)CO
| synonyms = Melanotan; Melanotan-1; Melanotan I; CUV1647; EPT1647; NDP-MSH; NDP-α-MSH; [Nle<sup>4</sup>,<small>D</small>-Phe<sup>7</sup>]α-MSH
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C78H111N21O19/c1-5-6-19-52(91-75(116)61(41-101)97-72(113)57(34-46-24-26-49(103)27-25-46)94-74(115)60(40-100)88-44(4)102)68(109)92-54(28-29-64(105)106)70(111)96-59(36-48-38-83-42-87-48)73(114)93-56(33-45-16-8-7-9-17-45)71(112)90-53(22-14-31-84-78(81)82)69(110)95-58(35-47-37-85-51-20-11-10-18-50(47)51)67(108)86-39-63(104)89-55(21-12-13-30-79)77(118)99-32-15-23-62(99)76(117)98-65(43(2)3)66(80)107/h7-11,16-18,20,24-27,37-38,42-43,52-62,65,85,100-101,103H,5-6,12-15,19,21-23,28-36,39-41,79H2,1-4H3,(H2,80,107)(H,83,87)(H,86,108)(H,88,102)(H,89,104)(H,90,112)(H,91,116)(H,92,109)(H,93,114)(H,94,115)(H,95,110)(H,96,111)(H,97,113)(H,98,117)(H,105,106)(H4,81,82,84)/t52-,53-,54-,55-,56+,57-,58-,59-,60-,61-,62-,65-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UAHFGYDRQSXQEB-LEBBXHLNSA-N
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life = 30 perc<ref name=EMA2017/>
| excretion =
| pregnancy_category =
| licence_EU = igen
| routes_of_administration = [[Subcutaneous injection|S.C.]]; [[Intramuscular injection|I.M.]]; [[Intravenous injection|I.V.]]; [[szubkután implantátum]]; [[intranazális]]
}}
 
Az '''''afamelanotid''''' (CUV-1647; EPT-1647; Melanotan I; Melanotan™; MT I; Scenesse<ref name=":0">{{Cite web |url=http:// clinuvel.com/products-pipeline/scenesse |title=Clinuvel Pharmaceuticals. Scenesse® (afamelanotide 16mg) |accessdate=20180930}}</ref>)egy [[Melanocitastimuláló hormon|α-melanocitákat stimuláló hormon]] szintetikus analógja, amelyet 2015. január óta Európában az eritropoezises protoporfiriában (EPP) szenvedő emberek bőrkárosodásának megelőzésére használnak.
 
102

szerkesztés