„Aurotioprol” változatai közötti eltérés
[ellenőrzött változat] | [ellenőrzött változat] |
Tartalom törölve Tartalom hozzáadva
a hivatkozás áthelyezése az írásjel mögé, egyéb apróság AWB |
a forrás enwikiből |
||
1. sor:
{{csonk-kémia}}
{{Drugbox
| IUPAC_name = nátrium-aurotiopropanolszulfonát
| image = Aurotioprol.svg
36 ⟶ 34 sor:
| chemical_formula =
| C=3 | H=6 | Au=1 | Na=1 | O=4 | S=2
| molecular_weight = 390
| smiles = C(C(CS(=O)(=O)[O-])O)[S-].[Na+].[Au+]
| InChI = 1/C3H8O4S2.Au.Na/c4-3(1-8)2-9(5,6)7;;/h3-4,8H,1-2H2,(H,5,6,7);;/q;2*+1/p-2 | InChIKey = KBWWFTIQBJUOQR-NUQVWONBAF
| StdInChI = 1S/C3H8O4S2.Au.Na/c4-3(1-8)2-9(5,6)7;;/h3-4,8H,1-2H2,(H,5,6,7);;/q;2*+1/p-2
| StdInChIKey = KBWWFTIQBJUOQR-UHFFFAOYSA-L
| smiles = C(C(CS(=O)(=O)[O-])O)[S-].[Na+].[Au+]
}}
Az '''aurotioprol''' az [[arany]] egyik
| | last2 = Raffoux | first2 = C.
| last3 = Thomas | first3 = P.
| last4 = Tamisier | first4 = J. N.
| last5 = Busson | first5 = M.
| last6 = Gaucher | first6 = A.
| last7 = Streiff | first7 = F.
| title = HLA antigens and toxic reactions to sodium aurothiopropanol sulphonate and D-penicillamine in patients with rheumatoid arthritis
| journal = Annals of the Rheumatic Diseases
| volume = 44
| issue = 9
| pages = 621–624
| year = 1985
| pmid = 3876081
| pmc = 1001721 | doi=10.1136/ard.44.9.621
}}</ref><ref>{{Cite journal
| last1 = Veys | first1 = E. M.
| last2 = Mielants | first2 = H.
| last3 = Verbruggen | first3 = G.
| title = Goldsalts, levamisole and D-penicillamine as first choice slow-acting antirheumatic drugs in rheumatoid arthritis--a long-term follow-up study
| journal = Clinical and experimental rheumatology
| volume = 5
| issue = 2
| pages = 111–116
| year = 1987
| pmid = 3608266
}}</ref> intramuszkuláris ([[izom]]szövetbe adott) injekció formájában alkalmazva.
== Fordítás ==
|