„Biperidén” változatai közötti eltérés

104 bájt hozzáadva ,  11 évvel ezelőtt
sablon jav. + iw
(sablon jav. + iw)
| MolekulaTömeg = 311.461 g/mol
| smiles = OC(c1ccccc1)(CCN2CCCCC2)C4C3\C=C/C(C3)C4
| BioHaszn = 33 ± 5% (oralorális)
| FehérjeKöt = 60%
| Metabolizmus = máj (hidroxilació)
| eliminációs felezési időBioFelezésiIdő = 18 to 24 hoursóra
| Kiválasztás= vese
| TerhességAU = B2
| TerhességUS = C
| JogiUS = Rx-only
| Alkalmazás = OralOrális, [[intramuscularintramuszkuláris injectioninjekció|IM]], [[intravenousintravénás therapykezelés|IV]]
}}
 
A '''biperidén''' elsősorban egy antikolinerg gyógyszer, amely központi idegrendszeri hatást fejt ki. Rendelkezik perifériás hatással is, de ez minimális az [[atropin]]éval összehasonlítva. A biperidén kompetitíven kötődik a perifériás és központi muscarinreceptorokhoz (elsősorban M1-hez). Állatkísérletekben a biperidén kivédte a centrálisan-ható kolinerg szerek által kiváltott Parkinson szerű hatásokat (tremor és rigiditás).
 
 
==Készítmények==
*AKINETON
 
 
==Jegyzetek==
{{fordítás|en|Biperiden}}
 
[[en:Biperiden]]
[[de:Biperiden]]
[[nl:Biperideen]]
[[fi:Biperideeni]]
[[sv:Biperiden]]
[[pl:Biperyden]]