„Pipotiazin” változatai közötti eltérés

a
nincs szerkesztési összefoglaló
(Új oldal, tartalma: „{{gyógyszeresdoboz | Watchedfields = | verifiedrevid = | IUPACnév = 10-[3-[4-(2-hydroxyethyl)piperidin-1-yl]propyl]-N,N-dimethylphenothiazine-2-sulfonamide | Kép …”)
 
a
| DrugBank =
|Képlet=C<sub>24</sub>H<sub>33</sub>N<sub>3</sub>O<sub>3</sub>S<sub>2</sub>
| SMILES=CN(C)S(=O)(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN4CCC(CC4)CCO
| MolekulaTömeg = 475.66712
| BioHaszn =
1 028

szerkesztés