„Violaxantin” változatai közötti eltérés

961 bájt hozzáadva ,  10 évvel ezelőtt
+chembox
a (pár link)
(+chembox)
{{chembox
|ImageFile=violaxanthin.svg
|ImageSize=250px
| IUPACName_hidden = yes
|IUPACName=(1S,4S,6R)-1-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(1S,4S,6R)-4-Hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-4-ol
|OtherNames=5,6:5',6'-Diepoxy-5,5',6,6'-tetrahydro-β-carotene-3,3'-diol, Zeaxanthin diepoxide, ''all''-''trans''-Violaxanthin, E161e
|Section1= {{Chembox Identifiers
| CASNo=126-29-4
| PubChem=448438
| SMILES=C\C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@]12C(C[C@@H](C[C@]1(O2)C)O)(C)C)\C=C\C=C(/C)\C=C\[C@]34C(C[C@@H](C[C@]3(O4)C)O)(C)C
}}
|Section2= {{Chembox Properties
| Formula=C<sub>40</sub>H<sub>56</sub>O<sub>4</sub>
| MolarMass=600,85 g/mol
| Appearance=Narancssárga kristályok
| Density=
| MeltingPt=200 °C
| BoilingPt=
| Solubility=
}}
|Section3= {{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}}
 
A '''violaxantin''' (E161e) egy a természetben is előforduló, ipari mennyiségben szintézis során előállított, sárga színű pigment. A [[karotinoidok]] közé, azon belül is a [[xantofill]]ek közé tartozik.