Főmenü megnyitása
Androsztán
Androstane 5alpha-beta.png
IUPAC-név (8S,9S,10S,13S,14S)-10,13-dimetil-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradekahidro-1H-ciklopenta[a]fenantrén
Más nevek Etioallocholane
Kémiai azonosítók
CAS-szám 24887-75-0,
438-22-2 (5α)
438-23-3 (5β)
PubChem 94144
ChemSpider 5256872
ChEBI 35509
SMILES
C[C@@]12[C@](CCC2)([H])[C@]3([H])CCC4([H])CCCC[C@]4(C)[C@@]3([H])CC1
InChI
1/C19H32/c1-18-11-5-7-16(18)15-9-8-14-6-3-4-12-19(14,2)17(15)10-13-18/h14-17H,3-13H2,1-2H3/t14?,15-,16-,17-,18-,19-/m0/s1
StdInChIKey QZLYKIGBANMMBK-FZFXZXLVSA-N
Kémiai és fizikai tulajdonságok
Kémiai képlet C19H32
Moláris tömeg 260,46 g/mol
Sűrűség 0,95 g/ml
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

Az androsztán a szteroidok közé tartozó telített szénhidrogén. Két izomerje létezik, az 5α-androsztán és az 5β-androsztán.

ForrásokSzerkesztés

FordításSzerkesztés

Ez a szócikk részben vagy egészben az Androstane című angol Wikipédia-szócikk ezen változatának fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel.