kolán
IUPAC-név (5S,8R,9S,10S,13R,14S,17R)-10,13-dimetil-17-[(1R)-1-metilbutil]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradekahidro-1H-ciklopenta[a]fenantrén
Kémiai azonosítók
CAS-szám 80373-86-0
PubChem 6857530
ChemSpider 5256866
ChEBI 35519
SMILES
CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CCCC4)C)C
InChI
1/C24H42/c1-5-8-17(2)20-12-13-21-19-11-10-18-9-6-7-15-23(18,3)22(19)14-16-24(20,21)4/h17-22H,5-16H2,1-4H3/t17-,18?,19+,20-,21+,22+,23+,24-/m1/s1
InChIKey QSHQKIURKJITMZ-BRPMRXRMSA-N
Kémiai és fizikai tulajdonságok
Kémiai képlet C24H42
Moláris tömeg 330,59 g/mol
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

A kolán a szteroidok közé tartozó szénhidrogén, az epesavak alapvegyülete.[1] Két sztereoizomerje az 5α-kolán és az 5β-kolán.

Jegyzetek szerkesztés

  1. Römpp vegyészeti lexikon: Második kötet F–K. Budapest: Műszaki Könyvkiadó, 922. o. (1982). ISBN 963 10 3813 0 

További olvasnivalók szerkesztés

Fordítás szerkesztés

Ez a szócikk részben vagy egészben a Cholane című angol Wikipédia-szócikk ezen változatának fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel. Ez a jelzés csupán a megfogalmazás eredetét és a szerzői jogokat jelzi, nem szolgál a cikkben szereplő információk forrásmegjelöléseként.