Monatin
Monatin.png
IUPAC-név (2S,4S)-4-amino-2-hidroxi-2-(1H-indol-3-ilmetil)-pentándisav
Más nevek 4-amino-2-hidroxi-2-(indol-3-ilmetil)glutársav
(S)-4-hidroxi-4-(1H-indol-3-ilmetil)-l-glutaminsav
Kémiai azonosítók
CAS-szám 146142-94-1
SMILES
O[C@]([C@](O)=O)(C[C@H](N)C(O)=O)CC2=CNC1=CC=CC=C12
Kémiai és fizikai tulajdonságok
Kémiai képlet C14H16N2O5
Moláris tömeg 292,29 g/mol
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

A monatin fehér színű por.[1] A természetben is előfordul a dél-afrikai Transvaal tartományban élő Sclerochiton ilicifolius[2][3] nevű növény kérgében és gyökerében.

Édesítőszerként használják, mert kb. 1000–1400-szor édesebb, mint az ugyanolyan súlyú cukor. Ez az eddig ismert legerősebb édesítőszer.

Előnye, hogy más édesítőktől eltérően egyáltalán nem tartalmaz szénhidrátot vagy hasonló vegyületet, ezért gyakorlatilag 0 az étkezési energiatartalma. A lebontása során sem keletkezik szénhidrát, így nem károsítja a fogakat. Nincs keserű vagy fémes utóíze (mint pl. a szacharinnak). Négy térizomerje van, melyek kombinálhatók egymással vagy akár szénhidrátokkal is. Nem tartalmaz fenilalanint, mint az aszpartám, ezért fenilketonuriában szenvedők is fogyaszthatják.

Könnyen alakul laktámmá: 50 °C-on, 7-es pH-értéknél három óra alatt az egész mennyiség, és ilyenkor teljesen elveszíti az édes ízét.[4] Ráadásul a laktám-alak sztereoizomerje keserű. Ez megnehezíti a szintézisét.

Az utóbbi években több szabadalom is született a mesterséges előállítására.[5][6][7][8] Könnyen lehet, hogy az elkövetkező évek legfontosabb édesítőszere lesz.


JegyzetekSzerkesztés

  1. Monatin manufacturers
  2. Sclerochiton ilicifolius
  3. Sclerochiton ilicifolius[halott link]
  4. Loss of Sweetness of Monatin with Lactamization
  5. Synthesis of monatin-A high intensity natural sweetener. [2010. december 15-i dátummal az eredetiből archiválva]. (Hozzáférés: 2011. április 25.)
  6. PRODUCTION OF MONATIN AND MONATIN PRECURSORS[halott link]
  7. MONATIN TABLETOP SWEETENER COMPOSITIONS AND METHODS OF MAKING SAME
  8. PRODUCTION OF MONATIN STEREOISOMERS

ForrásokSzerkesztés

FordításSzerkesztés

Ez a szócikk részben vagy egészben a Monatin című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel. Ez a jelzés csupán a megfogalmazás eredetét jelzi, nem szolgál a cikkben szereplő információk forrásmegjelöléseként.