Főmenü megnyitása

Módosítások

2 bájt hozzáadva ,  4 hónappal ezelőtt
IUPAC-név magyarítás
{{Drugbox
| IUPAC_name = (5α,6α)-4,5-epoxyepoxi-6-(3,6,9,12,15,18,21-heptaoxadocosheptaoxadokozo-1-yloxyiloxi)-17-(2-propenpropén-1-ylil)morphinanmorfinán-3,14-diol
| image = Naloxegol.svg
| width =
| KEGG = D10479
| C= 34| H= 53 | N=1 | O= 11
| molecular_weight = 651.,785 g/mol
| smiles = COCCOCCOCCOCCOCCOCCOCCO[C@H]1CC[C@]2([C@H]3Cc4ccc(c5c4[C@]2([C@H]1O5)CCN3CC=C)O)O
| StdInChI = 1S/C34H53NO11/c1-3-9-35-10-8-33-30-26-4-5-27(36)31(30)46-32(33)28(6-7-34(33,37)29(35)25-26)45-24-23-44-22-21-43-20-19-42-18-17-41-16-15-40-14-13-39-12-11-38-2/h3-5,28-29,32,36-37H,1,6-25H2,2H3/t28-,29+,32-,33-,34+/m0/s1
21 960

szerkesztés