IUPAC-név (2E,4E)-5-(2H-1,3-benzodioxol-5-il)-1-(piperidin-1-il)penta-2,4-dién-1-on
Kémiai azonosítók
CAS-szám 94-62-2
PubChem 638024
ChemSpider 553590
EINECS-szám 202-348-0
DrugBank DB12582
KEGG C03882
ChEBI 28821
RTECS szám TN2321500
InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18) 7-3-2-6-14-8-9-15-16(12-14) 21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+
Beilstein 90741
ChEMBL 43185
Kémiai és fizikai tulajdonságok
Kémiai képlet C17H19NO3
Moláris tömeg 285,34 g/mol
Megjelenés fehér vagy világosszürke
Halmazállapot szilárd
Sűrűség 1,211 g/cm³
Olvadáspont 130 °C
Forráspont 498,524 °C
Oldhatóság (vízben) 40 mg/l[1]
Savasság (pKa) 1,98
Megoszlási hányados 0,48
MSDS ScienceLab.com
EU osztályozás Környezetre veszélyes N Ártalmas anyag Xn
NFPA 704
NFPA 704.svg
R mondatok R22 R51/53
S mondatok S61
Lobbanáspont 255,3 °C
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

A piperin sárgás vagy színtelen, erősen borsízű szerves vegyület. A fekete borsban 5–9%-ban fordul elő, ez adja a bors jellegzetes ízét. Neve is a bors latin (piper) ill. görög (πιπέρι = piperi) nevéből származik.[2]

Sztereoizomerje a kavicin(en). A borsban megtalálhatók a piperin egyéb geometriai izomerjei is (cisz-transz izomerek), azonban előfordulásuk és kristályosodási hajlamuk a piperinénél jóval kisebb.[3]

Hideg vízben csak nagyon nehezen, benzolban, ecetsavban,[4] alkoholban és éterben jól oldódik. Igen gyenge bázis, a kémhatása semleges. Híg savakban oldhatatlan, csak tömény ásványi savakkal képez sókat, melyek víz hatására ismét szétesnek.

A helyileg határolt égető érzéstől és a csekély mértékű helyi hőmérséklet-csökkenéstől eltekintve emberre és állatra még nagyobb mennyiségben sincs különösebb hatással.

A piperin bizonyítottan természetes antidepresszáns hatású vegyület. Hatása van a monoamin-oxidáz enzimrendszer működésére, pontosabban gátolja ezt. (MAO-A, MAO-B) így magasabb főleg szerotonin és noradrenalin, dopamin szintet eredményezve.

Így csökkentheti a depressziót, a szorongást és javíthatja a belső közérzetet/egyensúlyt.


  1. 18 °C-on.
  2. Fülöp József: Rövid kémiai értelmező és etimológiai szótár. Celldömölk: Pauz–Westermann Könyvkiadó Kft. 1998. 114. o. ISBN 963 8334 96 7  
  3. Orosz György, Szabó Dénes: Szerves kémia praktikum
  4. parchem
