Adenozin-monofoszfát

Adenozin-monofoszfát
Adenosinmonophosphat protoniert.svg
Az AMP szerkezeti képlete
Adenosine-monophosphate-anion-3D-balls.png
Az AMP pálcikamodellje
IUPAC-név [(2R,3S,4R,5R)-5-(6-aminopurin-9-il)-3,4-dihidroxioxolán-2-il]metil-dihidrogén-foszfát
Más nevek adenozin 5'-monofoszfát
Kémiai azonosítók
CAS-szám 61-19-8
PubChem 6083
ChemSpider 5858
DrugBank DB00131
KEGG C00020
MeSH Adenosine+monophosphate
ChEBI 16027
SMILES
O=P(O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3O
InChI
1/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1
StdInChIKey UDMBCSSLTHHNCD-KQYNXXCUSA-N
UNII 415SHH325A
ChEMBL 752
Kémiai és fizikai tulajdonságok
Kémiai képlet C10H14N5O7P
Moláris tömeg 347,22 g/mol
Megjelenés fehér, kristályos anyag
Sűrűség 2,32 g/ml
Olvadáspont 178–185 °C
Savasság (pKa) 0,9[forrás?], 3,8, 6,1
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

Az adenozin-monofoszfát (AMP) más néven 5'-adenilsav a purin nukleotidok közé tartozó szerves vegyület, nukleotid.[1] Az AMP egy foszfátcsoportból, egy ribózból és a nukleobázis adeninből áll; a foszforsav és az adenozin nukleozid észtere. Szubsztituensként az adenilil- előtag formát ölti.[2]

Szintézise és lebontásaSzerkesztés

Az AMP nem rendelkezik az ADP-hez és az ATP-hez kapcsolódó nagy energiájú foszfoanhidrid-kötéssel. AMP előállítható két ADP molekulából:

2 ADP → ATP + AMP

Emellett az AMP előállítható az ADP egyik nagy energiájú foszfátkötésének hidrolízisével:

ADP + H2O → AMP + Pi

Az AMP az ATP-nek AMP-vé és pirofoszfáttá történő hidrolízisével is kialakulhat:

ATP + H2O → AMP + PPi

Amikor az RNS-t élő szervezetek bontják, nukleozid-monofoszfátok, köztük adenozin-monofoszfát molekulák képződnek.

Az AMP az alábbiak szerint alakítható ATP-vé:

AMP + ATP → 2 ADP (az adenilát-kináz enzimmel az ellenkező irányba)

ADP + Pi → ATP (ezt a lépést leggyakrabban aerob élőlényekben hajtja végre az ATP-szintáz enzim az oxidatív foszforilezés során)

Az AMP a mioadenilát-deamináz enzimmel átalakítható inozinsavvá, más néven IMP-vé, ammóniacsoportot szabadítva fel ezzel. Katabolikus úton az adenozin-monofoszfát átalakulhat húgysavvá, amely emlősökben ilyen formában ürül ki a szervezetből.[3]

A ciklikus AMP (cAMP)Szerkesztés

Az AMP ciklikus struktúraként ciklikus AMP (vagy cAMP) néven ismert. Bizonyos sejtekben az adenilát-cikláz enzim ATP-ből állítja elő a cAMP-t, ezt a reakciót általában hormonok, például adrenalin vagy glukagon szabályozzák. A cAMP fontos szerepet játszik az intracelluláris jelátvitelben.[4]

JegyzetekSzerkesztés

  1. PubChem: Adenosine monophosphate (angol nyelven). pubchem.ncbi.nlm.nih.gov. (Hozzáférés: 2021. március 28.)
  2. (1997. november 1.) „Nomenclature of Carbohydrates: (Recommendations 1996)” (en nyelven). Journal of Carbohydrate Chemistry 16 (8), 1191–1280. o. DOI:10.1080/07328309708005748. ISSN 0732-8303.  
  3. Maiuolo, Jessica, Santo (2016. június 1.). „Regulation of uric acid metabolism and excretion” (en nyelven). International Journal of Cardiology 213, 8–14. o. DOI:10.1016/j.ijcard.2015.08.109.  
  4. Biokémia II. Biokémiai szabályozás|Digitális Tankönyvtár (magyar nyelven). regi.tankonyvtar.hu. (Hozzáférés: 2021. március 28.)

FordításSzerkesztés

  • Ez a szócikk részben vagy egészben az Adenosine monophosphate című angol Wikipédia-szócikk ezen változatának fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel. Ez a jelzés csupán a megfogalmazás eredetét jelzi, nem szolgál a cikkben szereplő információk forrásmegjelöléseként.