Főmenü megnyitása
Izocitromsav
Isocitric acid.svg
Kémiai azonosítók
CAS-szám 320-77-4
PubChem 1198
MeSH isocitrate
SMILES
C(C(C(C(=O)O)O)C(=O)O)C(=O)O
Kémiai és fizikai tulajdonságok
Kémiai képlet C6H8O7
Moláris tömeg 192,124 g/mol
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

Az izocitromsav az izocitrát protonált formája. Az izocitrát a citromsavciklus egyik szubsztrátja, átalakulását az izocitrát-dehidrogenáz katalizálja. Az izocitromsav sói vagy észterei az izocitrátok.